Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Coluracetam(MKC-231) is a new choline uptake enhancer. |
|---|
| Catalog Num | A13516 |
|---|---|
| Formula | C19H23N3O3 |
| Molecular Weight | 341.4 |
| CAS Number | 135463-81-9 |
| SMILES | CC1=C(OC2=NC3=C(CCCC3)C(=C12)NC(=O)CN4CCCC4=O)C |
| Synonyms | MKC-231, MKC231, MKC 231 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (196.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 23 mg/mL (67.36 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.29 mL | 146.46 mL | 292.91 mL |
| 0.5 mM | 5.86 mL | 29.29 mL | 58.58 mL |
| 1 mM | 2.93 mL | 14.65 mL | 29.29 mL |
| 5 mM | 0.59 mL | 2.93 mL | 5.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
