Coptisine chloride
Catalog No.: A14541
Coptisin chloride is an MAO-A inhibitor. Coptisin chloride is a bacterial collagenase inhibitor.
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
Adooq Products cited in reputable paper
Biological Activity
| Discription | Coptisin chloride is an MAO-A inhibitor. Coptisin chloride is a bacterial collagenase inhibitor. | ||
|---|---|---|---|
| Targets |
|
Chemical Information
| Catalog Num | A14541 |
|---|---|
| Formula | C19H14ClNO4 |
| Molecular Weight | 355.78 |
| CAS Number | 6020-18-4 |
| SMILES | C1C[N+]2=C(C=C3C=CC4=C(C3=C2)OCO4)C5=CC6=C(C=C51)OCO6.[Cl-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Solubility
| In vitro | DMSO | 3 mg/mL (8.43 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
Preparing Stock Solutions
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.11 mL | 140.54 mL | 281.07 mL |
| 0.5 mM | 5.62 mL | 28.11 mL | 56.21 mL |
| 1 mM | 2.81 mL | 14.05 mL | 28.11 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.62 mL |
Useful Calculator
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
Keywords: buy Coptisine chloride | Coptisine chloride Supplier | purchase Coptisine chloride | Coptisine chloride cost | Coptisine chloride manufacturer | order Coptisine chloride | Coptisine chloride distributor
| buy 6020-18-4 | 6020-18-4 Supplier | purchase 6020-18-4 | 6020-18-4 cost | 6020-18-4 manufacturer | order 6020-18-4 | 6020-18-4 distributor