Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CPI 0610 is a small molecule inhibitor of the Bromodomain and Extra-Terminal (BET) family of proteins, with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16076 |
|---|---|
| Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 |
| CAS Number | 1380087-89-7 |
| SMILES | O=C(N)C[C@@H]1N=C(C2=CC=C(Cl)C=C2)C3=CC=CC=C3C4=C1ON=C4C |
| Synonyms | CPI0610, CPI-0610 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (191.35 mM) | |
| Water | Insoluble | ||
| Ethanol | 12 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.34 mL | 136.68 mL | 273.36 mL |
| 0.5 mM | 5.47 mL | 27.34 mL | 54.67 mL |
| 1 mM | 2.73 mL | 13.67 mL | 27.34 mL |
| 5 mM | 0.55 mL | 2.73 mL | 5.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
