Lirametostat (CPI-1205) is a highly potent (biochemical IC50 = 0.002 μM, cellular EC50 = 0.032 μM) and selective inhibitor of EZH2.
Loading distributor info...
| Description | Lirametostat (CPI-1205) is a highly potent (biochemical IC50 = 0.002 μM, cellular EC50 = 0.032 μM) and selective inhibitor of EZH2. |
|---|
| Catalog Num | A16357 |
|---|---|
| Formula | C27H33F3N4O3 |
| Molecular Weight | 518.57 |
| CAS Number | 1621862-70-1 |
| SMILES | CC1=CC(OC)=C(CNC(C2=C(C)N([C@H](C)C3CCN(CC(F)(F)F)CC3)C4=C2C=CC=C4)=O)C(N1)=O |
| Synonyms | CPI 1205, CPI1205 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (173.55 mM) | |
| Water | Insoluble | ||
| Ethanol | 90 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.28 mL | 96.42 mL | 192.84 mL |
| 0.5 mM | 3.86 mL | 19.28 mL | 38.57 mL |
| 1 mM | 1.93 mL | 9.64 mL | 19.28 mL |
| 5 mM | 0.39 mL | 1.93 mL | 3.86 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
