Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | CPI203 is a novel potent, selective and cell permeable inhibitor of the bromodomain and extra terminal (BET) family protein BRD4 with an IC50 of ~37 nM (BRD4 α-screen assay). |
|---|
| Catalog Num | A13068 |
|---|---|
| Formula | C19H18ClN5OS |
| Molecular Weight | 399.9 |
| CAS Number | 1446144-04-2 |
| SMILES | CC1=C(SC2=C1C(=N[C@H](C3=NN=C(N32)C)CC(=O)N)C4=CC=C(C=C4)Cl)C |
| Synonyms | CPI203 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 78 mg/mL (195.04 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (12.5 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.01 mL | 125.03 mL | 250.06 mL |
| 0.5 mM | 5 mL | 25.01 mL | 50.01 mL |
| 1 mM | 2.5 mL | 12.5 mL | 25.01 mL |
| 5 mM | 0.5 mL | 2.5 mL | 5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
