Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CPI-444 is a potent, oral and selective A2A receptor (A2AR) antagonist, which induces antitumor responses. |
|---|
| Catalog Num | A19242 |
|---|---|
| Formula | C20H21N7O3 |
| Molecular Weight | 407.43 |
| CAS Number | 1202402-40-1 |
| SMILES | NC1=NC(C2=CC=C(C)O2)=C(N=NN3CC4=NC(CO[C@@H]5COCC5)=CC=C4)C3=N1 |
| Synonyms | CPI444, CPI 444; V81444, V 81444, V-81444; ciforadenant |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (174.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.54 mL | 122.72 mL | 245.44 mL |
| 0.5 mM | 4.91 mL | 24.54 mL | 49.09 mL |
| 1 mM | 2.45 mL | 12.27 mL | 24.54 mL |
| 5 mM | 0.49 mL | 2.45 mL | 4.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
