Cu-BTC, a metal-organic framework composed of copper(II) ions and 1,3,5-benzenetricarboxylic acid, serves as a versatile platform for various applications in chemical research. It demonstrates significant porosity and surface area, allowing for effective gas adsorption and separation. Cu-BTC is particularly researched for its potential in catalysis, gas storage, and sensing applications due to its robust structural integrity and chemical stability. This makes it a valuable reagent for studies in materials science and environmental chemistry.
Cu-BTC, a metal-organic framework composed of copper(II) ions and 1,3,5-benzenetricarboxylic acid, serves as a versatile platform for various applications in chemical research. It demonstrates significant porosity and surface area, allowing for effective gas adsorption and separation. Cu-BTC is particularly researched for its potential in catalysis, gas storage, and sensing applications due to its robust structural integrity and chemical stability. This makes it a valuable reagent for studies in materials science and environmental chemistry.
Product Information
Catalog Num
B17575
Formula
C9H6CuO6
Molecular Weight
273.69
CAS Number
309721-49-1
SMILES
[Cu].O=C(O)C=1C=C(C=C(C1)C(=O)O)C(=O)O
Synonyms
1,3,5-Benzenetricarboxylic acid, copper(2+) salt (2:3)
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
