CU-CPT-9a
Catalog No.: A19785
TLR8 antagonist
CU-CPT-9a is a specific TLR8 antagonist, with an IC50 of 0.5 nM.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | CU-CPT-9a is a specific TLR8 antagonist, with an IC50 of 0.5 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19785 |
|---|---|
| Formula | C17H15NO2 |
| Molecular Weight | 265.31 |
| CAS Number | 2165340-32-7 |
| SMILES | OC1=C(C)C=C(C=C1)C2=CC=NC3=CC(OC)=CC=C32 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (192.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.69 mL | 188.46 mL | 376.92 mL |
| 0.5 mM | 7.54 mL | 37.69 mL | 75.38 mL |
| 1 mM | 3.77 mL | 18.85 mL | 37.69 mL |
| 5 mM | 0.75 mL | 3.77 mL | 7.54 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2