Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cyanidin-3-O-glucoside chloride is a natural anthocyanin found in the fruits of some plants. |
|---|
| Catalog Num | A14635 |
|---|---|
| Formula | C21H21ClO11 |
| Molecular Weight | 484.8 |
| CAS Number | 7084-24-4 |
| SMILES | C1=CC(=C(C=C1C2=C(C=C3C(=CC(=CC3=[O+]2)O)O)OC4C(C(C(C(O4)CO)O)O)O)O)O.[Cl-] |
| Synonyms | Kuromanin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (183.56 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.63 mL | 103.14 mL | 206.27 mL |
| 0.5 mM | 4.13 mL | 20.63 mL | 41.25 mL |
| 1 mM | 2.06 mL | 10.31 mL | 20.63 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
