Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | D-Luciferin is a popular bioluminescent substrate of luciferase in the presence of ATP, used in luciferase-based bioluminescence imaging and cell-based high-throughput screening applications. |
|---|
| Catalog Num | A13789 |
|---|---|
| Formula | C11H8N2O3S2 |
| Molecular Weight | 280.32 |
| CAS Number | 2591-17-5 |
| SMILES | O=C([C@@H]1N=C(C2=NC3=CC=C(O)C=C3S2)SC1)O |
| Synonyms | Firefly Luciferin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (171.23 mM) | |
| Water | Insoluble | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.67 mL | 178.37 mL | 356.74 mL |
| 0.5 mM | 7.13 mL | 35.67 mL | 71.35 mL |
| 1 mM | 3.57 mL | 17.84 mL | 35.67 mL |
| 5 mM | 0.71 mL | 3.57 mL | 7.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
