Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dabrafenib Mesylate is a novel, potent, and selective Raf kinase inhibitor that is capableof inhibiting the kinase activity of wild-type B-Raf, B-RafV600Eand c-Raf with IC50 values of 3.2, 0.8, and 5.0 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15059 |
|---|---|
| Formula | C24H24F3N5O5S3 |
| Molecular Weight | 615.67 |
| CAS Number | 1195768-06-9 |
| SMILES | CC(C)(C)C1=NC(=C(S1)C2=NC(=NC=C2)N)C3=C(C(=CC=C3)NS(=O)(=O)C4=C(C=CC=C4F)F)F.CS(=O)(=O)O |
| Synonyms | GSK-2118436 Mesylate, GSK2118436 Mesylate, GSK 2118436 Mesylate, GSK 2118436B |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 96 mg/mL (155.92 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (8.12 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.24 mL | 81.21 mL | 162.42 mL |
| 0.5 mM | 3.25 mL | 16.24 mL | 32.48 mL |
| 1 mM | 1.62 mL | 8.12 mL | 16.24 mL |
| 5 mM | 0.32 mL | 1.62 mL | 3.25 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
