Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Daidzein structurally belongs to the group of isoflavones. Daidzein can be converted to its end metabolite S-equol in some humans based on the presence of certain intestinal bacteria. Based on several decades of research, S-equol has potential for significant health benefits. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10282 |
|---|---|
| Formula | C15H10O4 |
| Molecular Weight | 254.24 |
| CAS Number | 486-66-8 |
| SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O)O |
| Synonyms | 4',7-Dihydroxyisoflavone, Daidzeol, Isoaurostatin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (176.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.33 mL | 196.66 mL | 393.33 mL |
| 0.5 mM | 7.87 mL | 39.33 mL | 78.67 mL |
| 1 mM | 3.93 mL | 19.67 mL | 39.33 mL |
| 5 mM | 0.79 mL | 3.93 mL | 7.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
