Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dehydroepiandrosterone is an important endogenous steroid hormone. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10296 |
|---|---|
| Formula | C19H28O2 |
| Molecular Weight | 288.43 |
| CAS Number | 53-43-0 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC=C4[C@@]3(CC[C@@H](C4)O)C |
| Synonyms | DHEA, androstenolone, prasterone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 53 mg/mL (183.75 mM) | |
| Water | Insoluble | ||
| Ethanol | 53 mg/mL (183.75 mM) | ||
| In vivo | 5%DMSO+30% PEG300+5%Tween-80+ddH2O | 7 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.67 mL | 173.35 mL | 346.7 mL |
| 0.5 mM | 6.93 mL | 34.67 mL | 69.34 mL |
| 1 mM | 3.47 mL | 17.34 mL | 34.67 mL |
| 5 mM | 0.69 mL | 3.47 mL | 6.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
