Loading distributor info...
| Description | DEL-22379 is a potent and selective ERK Dimerization inhibitor that inhibits ERK Dimerization without affecting ERK phosphorylation, forestalls tumorigenesis driven by RAS-ERK pathway oncogenes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15802 |
|---|---|
| Formula | C26H28N4O3 |
| Molecular Weight | 444.55 |
| CAS Number | 181223-80-3 |
| SMILES | O=C1NC2=CC=C(NC(CCN3CCCCC3)=O)C=C2C1=CC4=CNC5=CC=C(OC)C=C54 |
| Synonyms | DEL22379, DEL 22379 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (177.71 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.49 mL | 112.47 mL | 224.95 mL |
| 0.5 mM | 4.5 mL | 22.49 mL | 44.99 mL |
| 1 mM | 2.25 mL | 11.25 mL | 22.49 mL |
| 5 mM | 0.45 mL | 2.25 mL | 4.5 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
