Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Dibutyryl-cAMP is a cell-permeable PKA activator by mimicing the action of endogenous cAMP. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15914 |
|---|---|
| Formula | C18H23N5NaO8P |
| Molecular Weight | 491.37 |
| CAS Number | 16980-89-5 |
| SMILES | CCCC(=O)NC1=NC=NC2=C1N=CN2C3C(C4C(O3)COP(=O)(O4)[O-])OC(=O)CCC.[Na+] |
| Synonyms | Bucladesine sodium salt |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 88 mg/mL (179.09 mM) | |
| Water | Warmed: 88 mg/mL (179.09 mM) | ||
| Ethanol | Warmed: 17 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.35 mL | 101.76 mL | 203.51 mL |
| 0.5 mM | 4.07 mL | 20.35 mL | 40.7 mL |
| 1 mM | 2.04 mL | 10.18 mL | 20.35 mL |
| 5 mM | 0.41 mL | 2.04 mL | 4.07 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
