Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dicyclanil is an insect growth regulator compound with a similar chemical structure to cyromazine. |
|---|
| Catalog Num | A18684 |
|---|---|
| Formula | C8H10N6 |
| Molecular Weight | 190.21 |
| CAS Number | 112636-83-6 |
| SMILES | N#CC1=C(N)N=C(NC2CC2)N=C1N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 34 mg/mL (178.74 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (10.51 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 52.57 mL | 262.87 mL | 525.73 mL |
| 0.5 mM | 10.51 mL | 52.57 mL | 105.15 mL |
| 1 mM | 5.26 mL | 26.29 mL | 52.57 mL |
| 5 mM | 1.05 mL | 5.26 mL | 10.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
