Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
WARNING: Attention California Residents: This product can expose you to chemicals including Dienestrol , which is known to the State of California to cause cancer and birth defects or other reproductive harm. For more information, go to www.P65Warnings.ca.gov
| Discription | Dienestrol is a synthetic estrogen. |
|---|
| Catalog Num | A10307 |
|---|---|
| Formula | C18H18O2 |
| Molecular Weight | 266.34 |
| CAS Number | 84-17-3 |
| SMILES | C/C=C(/C(=C/C)/C1=CC=C(C=C1)O)\C2=CC=C(C=C2)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (180.23 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.55 mL | 187.73 mL | 375.46 mL |
| 0.5 mM | 7.51 mL | 37.55 mL | 75.09 mL |
| 1 mM | 3.75 mL | 18.77 mL | 37.55 mL |
| 5 mM | 0.75 mL | 3.75 mL | 7.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
