Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dihydroethidium is a cell-permeable blue fluorescent dye. |
|---|
| Catalog Num | A15930 |
|---|---|
| Formula | C21H21N3 |
| Molecular Weight | 315.42 |
| CAS Number | 104821-25-2 |
| SMILES | NC1=CC=C2C3=C(C=C(N)C=C3)C(C4=CC=CC=C4)N(CC)C2=C1 |
| Synonyms | PD-MY 003, PD-MY-003, PD-MY003, Hydroethidine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (183.89 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.7 mL | 158.52 mL | 317.04 mL |
| 0.5 mM | 6.34 mL | 31.7 mL | 63.41 mL |
| 1 mM | 3.17 mL | 15.85 mL | 31.7 mL |
| 5 mM | 0.63 mL | 3.17 mL | 6.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
