Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Diphenhydramine is a first-generation antihistamine possessing anticholinergic, antitussive, antiemetic and sedative properties which is mainly used to treat allergies. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10318 |
|---|---|
| Formula | C17H21NO.HCl |
| Molecular Weight | 291.82 |
| CAS Number | 147-24-0 |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
| Synonyms | DHM, DPH |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (167.91 mM) | |
| Water | 49 mg/mL (167.91 mM) | ||
| Ethanol | 49 mg/mL (167.91 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.27 mL | 171.34 mL | 342.68 mL |
| 0.5 mM | 6.85 mL | 34.27 mL | 68.54 mL |
| 1 mM | 3.43 mL | 17.13 mL | 34.27 mL |
| 5 mM | 0.69 mL | 3.43 mL | 6.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
