Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Diroximel fumarate (DRF) is a prodrug of monomethyl fumarate in a controlled-release formulation that rapidly and efficiently converts to MMF in the body. |
|---|
| Catalog Num | A20797 |
|---|---|
| Formula | C11H13NO6 |
| Molecular Weight | 255.22 |
| CAS Number | 1577222-14-0 |
| SMILES | O=C(OCCN1C(CCC1=O)=O)/C=C/C(OC)=O |
| Synonyms | ALKS 8700, ALKS-8700, ALKS8700; BIIB098, BIIB 098, BIIB-098 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (172.39 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.18 mL | 195.91 mL | 391.82 mL |
| 0.5 mM | 7.84 mL | 39.18 mL | 78.36 mL |
| 1 mM | 3.92 mL | 19.59 mL | 39.18 mL |
| 5 mM | 0.78 mL | 3.92 mL | 7.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
