Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Docusate Sodium is a laxative used to treat constipation, for constipation due to the use of opiates it maybe used with a stimulant laxative, can be taken by mouth or rectally. |
|---|
| Catalog Num | A16155 |
|---|---|
| Formula | C20H37NaO7S |
| Molecular Weight | 444.56 |
| CAS Number | 577-11-7 |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[Na+] |
| Synonyms | Dioctyl sulfosuccinate sodium salt |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (168.7 mM) | |
| Water | 15 mg/mL (33.73 mM) | ||
| Ethanol | 75 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.49 mL | 112.47 mL | 224.94 mL |
| 0.5 mM | 4.5 mL | 22.49 mL | 44.99 mL |
| 1 mM | 2.25 mL | 11.25 mL | 22.49 mL |
| 5 mM | 0.45 mL | 2.25 mL | 4.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
