Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | DY131(GSK 9089) is a novel selective agonist of ERRα and ERRβ. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15071 |
|---|---|
| Formula | C18H21N3O2 |
| Molecular Weight | 311.38 |
| CAS Number | 95167-41-2 |
| SMILES | CCN(CC)C1=CC=C(C=C1)C=NNC(=O)C2=CC=C(C=C2)O |
| Synonyms | GSK 9089, DY-131, DY 131, GSK9089, GSK-9089 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (176.63 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.12 mL | 160.58 mL | 321.15 mL |
| 0.5 mM | 6.42 mL | 32.12 mL | 64.23 mL |
| 1 mM | 3.21 mL | 16.06 mL | 32.12 mL |
| 5 mM | 0.64 mL | 3.21 mL | 6.42 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
