Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Econazole nitrate is an antifungal medication of the imidazole class. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10342 |
|---|---|
| Formula | C18H15Cl3N2O.HNO3 |
| Molecular Weight | 444.7 |
| CAS Number | 24169-02-6 |
| SMILES | C1=CC(=CC=C1COC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl.[N+](=O)(O)[O-] |
| Synonyms | NSC 243115 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (191.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (11.24 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.49 mL | 112.44 mL | 224.87 mL |
| 0.5 mM | 4.5 mL | 22.49 mL | 44.97 mL |
| 1 mM | 2.25 mL | 11.24 mL | 22.49 mL |
| 5 mM | 0.45 mL | 2.25 mL | 4.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
