Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EED226 is a polycomb repressive complex 2 (PRC2) inhibitor, which binds to the K27me3-pocket on embryonic ectoderm development (EED) and shows strong antitumor activity in xenograft mice model. |
|---|
| Catalog Num | A20673 |
|---|---|
| Formula | C17H15N5O3S |
| Molecular Weight | 369.4 |
| CAS Number | 2083627-02-3 |
| SMILES | O=S(C1=CC=C(C2=CN=C(NCC3=CC=CO3)N4C2=NN=C4)C=C1)(C)=O |
| Synonyms | EED-226; EED 226 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 64 mg/mL (173.25 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.07 mL | 135.35 mL | 270.71 mL |
| 0.5 mM | 5.41 mL | 27.07 mL | 54.14 mL |
| 1 mM | 2.71 mL | 13.54 mL | 27.07 mL |
| 5 mM | 0.54 mL | 2.71 mL | 5.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
