Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Efavirenz is a non-nucleoside reverse transcriptase inhibitor (NNRTI). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15826 |
|---|---|
| Formula | C14H9ClF3NO2 |
| Molecular Weight | 315.68 |
| CAS Number | 154598-52-4 |
| SMILES | C1CC1C#CC2(C3=C(C=CC(=C3)Cl)NC(=O)O2)C(F)(F)F |
| Synonyms | DMP 266, EFV, L-743726, L-743,726 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (177.4 mM) | |
| Water | Insoluble | ||
| Ethanol | 56 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.68 mL | 158.39 mL | 316.78 mL |
| 0.5 mM | 6.34 mL | 31.68 mL | 63.36 mL |
| 1 mM | 3.17 mL | 15.84 mL | 31.68 mL |
| 5 mM | 0.63 mL | 3.17 mL | 6.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
