Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EI1 is a potent and selective small molecule inhibitor of EZH2 with IC50 values of 15 nM and 13 nM for wild type EZH2 and EZH2 Y641F mutant, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12711 |
|---|---|
| Formula | C23H26N4O2 |
| Molecular Weight | 390.48 |
| CAS Number | 1418308-27-6 |
| SMILES | CCC(CC)N1C=CC2=C(C=C(C=C21)C#N)C(=O)NCC3=C(C=C(NC3=O)C)C |
| Synonyms | Ezh2 inhibitor, EI-1, EI 1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 39 mg/mL (99.87 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.61 mL | 128.05 mL | 256.1 mL |
| 0.5 mM | 5.12 mL | 25.61 mL | 51.22 mL |
| 1 mM | 2.56 mL | 12.8 mL | 25.61 mL |
| 5 mM | 0.51 mL | 2.56 mL | 5.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
