Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Elesclomol induces oxidative stress by provoking a buildup of reactive oxygen species within cancer cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10343 |
|---|---|
| Formula | C19H20N4O2S2 |
| Molecular Weight | 400.5 |
| CAS Number | 488832-69-5 |
| SMILES | CN(C(=S)C1=CC=CC=C1)NC(=O)CC(=O)NN(C)C(=S)C2=CC=CC=C2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 77 mg/mL (192.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+40%PEG300+5%Tween80??+50%H2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.97 mL | 124.84 mL | 249.69 mL |
| 0.5 mM | 4.99 mL | 24.97 mL | 49.94 mL |
| 1 mM | 2.5 mL | 12.48 mL | 24.97 mL |
| 5 mM | 0.5 mL | 2.5 mL | 4.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
