Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Eltrombopag olamine is a new, orally active thrombopoietin-receptor (c-mpl) agonist that stimulates thrombopoiesis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15078 |
|---|---|
| Formula | C29H36N6O6 |
| Molecular Weight | 564.63 |
| CAS Number | 496775-62-3 |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C(=C(N2)C)NN=C3C=CC=C(C3=O)C4=CC(=CC=C4)C(=O)O)C.C(CO)N.C(CO)N |
| Synonyms | Eltrombopag diethanolamine salt, Promacta, Revolade, SB-497115GR |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (150.54 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.71 mL | 88.55 mL | 177.11 mL |
| 0.5 mM | 3.54 mL | 17.71 mL | 35.42 mL |
| 1 mM | 1.77 mL | 8.86 mL | 17.71 mL |
| 5 mM | 0.35 mL | 1.77 mL | 3.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
