Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EMD638683 is a potent inhibitor of SGK1 with an IC50 value of 3 uM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15079 |
|---|---|
| Formula | C18H18F2N2O4 |
| Molecular Weight | 364.34 |
| CAS Number | 1181770-72-8 |
| SMILES | CCC1=C(C=CC(=C1C)O)C(=O)NNC(=O)C(C2=CC(=CC(=C2)F)F)O |
| Synonyms | EMD 638683, EMD-638683 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (186.64 mM) | |
| Water | Insoluble | ||
| Ethanol | 37 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.45 mL | 137.23 mL | 274.47 mL |
| 0.5 mM | 5.49 mL | 27.45 mL | 54.89 mL |
| 1 mM | 2.74 mL | 13.72 mL | 27.45 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.49 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
