Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Epirubicin is a cell-permeable anthracycline antitumor antibiotic. It is a stereoisomer(4?€?-epi-isomer) of doxorubicin that exhibits reduced cardiotoxicity. It is used to inhibit topoisomerase II and DNA helicase activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10345 |
|---|---|
| Formula | C27H30ClNO11 |
| Molecular Weight | 580 |
| CAS Number | 56390-09-1 |
| SMILES | C[C@H]1[C@@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)CO)O)N)O.Cl |
| Synonyms | Ellence, Pharmorubicin, Epirubicin Ebewe |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (155.17 mM) | |
| Water | Warmed: 90 mg/mL (155.17 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.24 mL | 86.21 mL | 172.41 mL |
| 0.5 mM | 3.45 mL | 17.24 mL | 34.48 mL |
| 1 mM | 1.72 mL | 8.62 mL | 17.24 mL |
| 5 mM | 0.34 mL | 1.72 mL | 3.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
