Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Eprodisate is an orally available disodium salt form of eprodisate, a negatively charged sulfonated inhibitor of fibrillogenesis, that can be used in the treatment of amyloid A (AA) amyloidosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16200 |
|---|---|
| Formula | C3H6Na2O6S2 |
| Molecular Weight | 248.17 |
| CAS Number | 36589-58-9 |
| SMILES | O=S(CCCS(=O)([O-])=O)([O-])=O.[Na+].[Na+] |
| Synonyms | 3-PDS, NC-503, 3PDS |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 43 mg/mL (173.25 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.29 mL | 201.47 mL | 402.95 mL |
| 0.5 mM | 8.06 mL | 40.29 mL | 80.59 mL |
| 1 mM | 4.03 mL | 20.15 mL | 40.29 mL |
| 5 mM | 0.81 mL | 4.03 mL | 8.06 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
