Signaling Pathway
DOT1L Inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | EPZ-5676 is a small molecule inhibitor of histone methyltransferase with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12735 |
|---|---|
| Formula | C30H42N8O3 |
| Molecular Weight | 562.7 |
| CAS Number | 1380288-87-8 |
| SMILES | CC(C)N(C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)O)C4CC(C4)CCC5=NC6=C(N5)C=C(C=C6)C(C)(C)C |
| Synonyms | EPZ5676, EPZ 5676 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 88 mg/mL (156.38 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 81 mg/mL (143.94 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.77 mL | 88.86 mL | 177.71 mL |
| 0.5 mM | 3.55 mL | 17.77 mL | 35.54 mL |
| 1 mM | 1.78 mL | 8.89 mL | 17.77 mL |
| 5 mM | 0.36 mL | 1.78 mL | 3.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
