Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Eriocitrin is a flavone glycoside found in lemon. Administration prior to acute exercise helped to maintain the redox status of liver glutathione. |
|---|
| Catalog Num | A12051 |
|---|---|
| Formula | C27H32O15 |
| Molecular Weight | 596.53 |
| CAS Number | 13463-28-0 |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (165.95 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.76 mL | 83.82 mL | 167.64 mL |
| 0.5 mM | 3.35 mL | 16.76 mL | 33.53 mL |
| 1 mM | 1.68 mL | 8.38 mL | 16.76 mL |
| 5 mM | 0.34 mL | 1.68 mL | 3.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
