Loading distributor info...
| Description | ETC-159 is a potent and specific inhibitor of Wnt secretion. ETC-159 inhibits beta-catenin reporter activity in a dose-dependent manner with an IC50 of 2.9 nM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A15840 |
|---|---|
| Formula | C19H17N7O3 |
| Molecular Weight | 391.38 |
| CAS Number | 1638250-96-0 |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC(=O)NC3=NN=C(C=C3)C4=CC=CC=C4 |
| Synonyms | ETC-1922159 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (171.19 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.55 mL | 127.75 mL | 255.51 mL |
| 0.5 mM | 5.11 mL | 25.55 mL | 51.1 mL |
| 1 mM | 2.56 mL | 12.78 mL | 25.55 mL |
| 5 mM | 0.51 mL | 2.56 mL | 5.11 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
