Loading distributor info...
| Description | Etofylline, also known as BRN-0251760, is a peroxisome proliferator-activated receptor (PPAR) agonist used to treat respiratory and cardiovascular disorders. Etofylline is often used as a bronchodilator. |
|---|
| Catalog Num | A17491 |
|---|---|
| Formula | C9H12N4O3 |
| Molecular Weight | 224.22 |
| CAS Number | 519-37-9 |
| SMILES | O=C(N1C)N(C)C2=C(N(CCO)C=N2)C1=O |
| Synonyms | Etofylline; Oxyphylline; Dilaphyllin; Frekaphyllin; Soluphylline; Theophylline; BRN 0251760; BRN-0251760; BRN0251760 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 41 mg/mL (182.85 mM) | |
| Water | 41 mg/mL (182.85 mM) | ||
| Ethanol | 41 mg/mL (182.85 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.6 mL | 223 mL | 445.99 mL |
| 0.5 mM | 8.92 mL | 44.6 mL | 89.2 mL |
| 1 mM | 4.46 mL | 22.3 mL | 44.6 mL |
| 5 mM | 0.89 mL | 4.46 mL | 8.92 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
