Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Evacetrapib (LY2484595) is a potent and selective inhibitor of CETP with IC50 of 5.5 nM, elevates HDL cholesterol without increases in aldosterone or blood pressure. Phase 3. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11397 |
|---|---|
| Formula | C31H36F6N6O2 |
| Molecular Weight | 638.65 |
| CAS Number | 1186486-62-3 |
| SMILES | CC1=CC(=C2C(=C1)[C@H](CCCN2CC3CCC(CC3)C(=O)O)N(CC4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F)C5=NN(N=N5)C)C |
| Synonyms | LY2484595, LY-2484595, LY 2484595 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 11 mg/mL (17.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 11 mg/mL (17.22 mM) | ||
| In vivo | 15% Captisol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.66 mL | 78.29 mL | 156.58 mL |
| 0.5 mM | 3.13 mL | 15.66 mL | 31.32 mL |
| 1 mM | 1.57 mL | 7.83 mL | 15.66 mL |
| 5 mM | 0.31 mL | 1.57 mL | 3.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
