Loading distributor info...
| Description | Fatostatin (125B11), a specific inhibitor of SREBP activation, impairs the activation of SREBP-1 and SREBP-2. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A21153 |
|---|---|
| Formula | C18H18N2S |
| Molecular Weight | 294.41 |
| CAS Number | 125256-00-0 |
| SMILES | CCCC1=NC=CC(C2=NC(C3=CC=C(C)C=C3)=CS2)=C1 |
| Synonyms | 125B11 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (251.34 mM) | |
| Water | Insoluble | ||
| Ethanol | 74 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.97 mL | 169.83 mL | 339.66 mL |
| 0.5 mM | 6.79 mL | 33.97 mL | 67.93 mL |
| 1 mM | 3.4 mL | 16.98 mL | 33.97 mL |
| 5 mM | 0.68 mL | 3.4 mL | 6.79 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
