Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fenoprofen calcium is used for symptomatic relief for rheumatoid arthritis, osteoarthritis, and mild to moderate pain. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11689 |
|---|---|
| Formula | C30H26CaO6 |
| Molecular Weight | 522.6 |
| CAS Number | 34597-40-5 |
| SMILES | CC(C1=CC(=CC=C1)OC2=CC=CC=C2)C(=O)[O-].CC(C1=CC(=CC=C1)OC2=CC=CC=C2)C(=O)[O-].[Ca+2] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 104 mg/mL (199 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL (19.13 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.14 mL | 95.68 mL | 191.35 mL |
| 0.5 mM | 3.83 mL | 19.14 mL | 38.27 mL |
| 1 mM | 1.91 mL | 9.57 mL | 19.14 mL |
| 5 mM | 0.38 mL | 1.91 mL | 3.83 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
