Fenticonazole nitrate
Catalog No.: A11852
Fenticonazole nitrate is an azole antifungal agent.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Fenticonazole nitrate is an azole antifungal agent. |
|---|
| Catalog Num | A11852 |
|---|---|
| Formula | C24H20Cl2N2OS.HNO3 |
| Molecular Weight | 518.41 |
| CAS Number | 73151-29-8 |
| SMILES | C1=CC=C(C=C1)SC2=CC=C(C=C2)COC(CN3C=CN=C3)C4=C(C=C(C=C4)Cl)Cl.[N+](=O)(O)[O-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 103 mg/mL (198.68 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (3.85 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.29 mL | 96.45 mL | 192.9 mL |
| 0.5 mM | 3.86 mL | 19.29 mL | 38.58 mL |
| 1 mM | 1.93 mL | 9.64 mL | 19.29 mL |
| 5 mM | 0.39 mL | 1.93 mL | 3.86 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2