Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | FK866, a highly specific noncompetitive inhibitor of nicotinamide phosphoribosyltransferase, represents a novel mechanism for induction of tumor cell apoptosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11279 |
|---|---|
| Formula | C24H29N3O2 |
| Molecular Weight | 391.5 |
| CAS Number | 658084-64-1 |
| SMILES | C1CN(CCC1CCCCNC(=O)/C=C/C2=CN=CC=C2)C(=O)C3=CC=CC=C3 |
| Synonyms | K 22.175, FK-866 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | 77 mg/mL (196.67 mM) | ||
| In vivo | 5% DMSO+40% PEG 300+5% Tween 80+50% ddH2O | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.54 mL | 127.71 mL | 255.43 mL |
| 0.5 mM | 5.11 mL | 25.54 mL | 51.09 mL |
| 1 mM | 2.55 mL | 12.77 mL | 25.54 mL |
| 5 mM | 0.51 mL | 2.55 mL | 5.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
