Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Flibanserin is a new drug being investigated for the prevention of HSDD in woman. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13860 |
|---|---|
| Formula | C20H21F3N4O |
| Molecular Weight | 390.4 |
| CAS Number | 167933-07-5 |
| SMILES | C1CN(CCN1CCN2C3=CC=CC=C3NC2=O)C4=CC=C(C=C4)C(F)(F)F |
| Synonyms | BIMT-17, BIMT 17, BIMT17, Flibanerins |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (179.3 mM) | |
| Water | Insoluble | ||
| Ethanol | 21 mg/mL (53.79 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.61 mL | 128.07 mL | 256.15 mL |
| 0.5 mM | 5.12 mL | 25.61 mL | 51.23 mL |
| 1 mM | 2.56 mL | 12.81 mL | 25.61 mL |
| 5 mM | 0.51 mL | 2.56 mL | 5.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
