Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fraxinellone is an insecticidal agent, inhibiting growth of larvae, used in the treatment and protection of crops and produce. Also, a naturally occurring compound used in the treatment of tumors. |
|---|
| Catalog Num | A13918 |
|---|---|
| Formula | C14H16O3 |
| Molecular Weight | 232.277 |
| CAS Number | 28808-62-0 |
| SMILES | CC1=C2C(=O)O[C@H]([C@@]2(CCC1)C)C3=COC=C3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (185.12 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.05 mL | 215.26 mL | 430.52 mL |
| 0.5 mM | 8.61 mL | 43.05 mL | 86.1 mL |
| 1 mM | 4.31 mL | 21.53 mL | 43.05 mL |
| 5 mM | 0.86 mL | 4.31 mL | 8.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
