Frentizole
Aβ-ABAD inhibitor
Frentizole, an FDA-approved immunosuppressive drug, is a novel inhibitor of the Aβ-ABAD interaction.
Loading distributor info...
Aβ-ABAD inhibitor
Frentizole, an FDA-approved immunosuppressive drug, is a novel inhibitor of the Aβ-ABAD interaction.
Loading distributor info...
| Description | Frentizole, an FDA-approved immunosuppressive drug, is a novel inhibitor of the Aβ-ABAD interaction. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A21335 |
|---|---|
| Formula | C15H13N3O2S |
| Molecular Weight | 299.35 |
| CAS Number | 26130-02-9 |
| SMILES | O=C(NC1=CC=CC=C1)NC2=NC3=CC=C(OC)C=C3S2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (193.75 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.41 mL | 167.03 mL | 334.06 mL |
| 0.5 mM | 6.68 mL | 33.41 mL | 66.81 mL |
| 1 mM | 3.34 mL | 16.7 mL | 33.41 mL |
| 5 mM | 0.67 mL | 3.34 mL | 6.68 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2