Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | G-1 is a nonsteroidal, high-affinity and selective agonist of GPR30 with a Ki of 11 nM. |
|---|
| Catalog Num | A19310 |
|---|---|
| Formula | C21H18BrNO3 |
| Molecular Weight | 412.28 |
| CAS Number | 881639-98-1 |
| SMILES | BrC1=C([C@H]2[C@]3([H])[C@](C=CC3)([H])C4=CC(C(C)=O)=CC=C4N2)C=C5C(OCO5)=C1 |
| Synonyms | G 1; G1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (172.21 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.26 mL | 121.28 mL | 242.55 mL |
| 0.5 mM | 4.85 mL | 24.26 mL | 48.51 mL |
| 1 mM | 2.43 mL | 12.13 mL | 24.26 mL |
| 5 mM | 0.49 mL | 2.43 mL | 4.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
