Signaling Pathway
Gamitrinib TPP is a GA mitochondrial matrix inhibitor. Gamitrinib TPP is offered as the hexafluorophosphate salt.
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Gamitrinib TPP is a GA mitochondrial matrix inhibitor. Gamitrinib TPP is offered as the hexafluorophosphate salt. |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13159 |
|---|---|
| Formula | C52H65N3O8P |
| Molecular Weight | 891.06 |
| CAS Number | 1131626-46-4 |
| SMILES | O=C(C=C1NC(/C(C)=C/C=C/[C@H](OC)[C@@H](OC(N)=O)/C(C)=C/[C@H](C)[C@H]2O)=O)C(NCCCCCC[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)=C(C[C@H](C[C@@H]2OC)C)C1=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
