Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GDC-0879 is a specific inhibitor of B-Raf kinase enzyme,targeting B-Raf (V600E) (IC50: 0.13 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10420 |
|---|---|
| Formula | C19H18N4O2 |
| Molecular Weight | 334.4 |
| CAS Number | 905281-76-7 |
| SMILES | C1C/C(=N\O)/C2=C1C=C(C=C2)C3=CN(N=C3C4=CC=NC=C4)CCO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 65 mg/mL (194.39 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (14.95 mM) | ||
| In vivo | 0.5% methylcellulose+0.2% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.9 mL | 149.52 mL | 299.04 mL |
| 0.5 mM | 5.98 mL | 29.9 mL | 59.81 mL |
| 1 mM | 2.99 mL | 14.95 mL | 29.9 mL |
| 5 mM | 0.6 mL | 2.99 mL | 5.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
