Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Genistein, a soy isoflavone, is a multiple tyrosine kinases (e.g., EGFR) inhibitor which acts as a chemotherapeutic agent against different types of cancer, mainly by altering apoptosis, the cell cycle, and angiogenesis and inhibiting metastasis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10425 |
|---|---|
| Formula | C15H10O5 |
| Molecular Weight | 270.24 |
| CAS Number | 446-72-0 |
| SMILES | OC1=C2C(OC=C(C3=CC=C(O)C=C3)C2=O)=CC(O)=C1 |
| Synonyms | NPI 031L |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (185.02 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (7.4 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37 mL | 185.02 mL | 370.04 mL |
| 0.5 mM | 7.4 mL | 37 mL | 74.01 mL |
| 1 mM | 3.7 mL | 18.5 mL | 37 mL |
| 5 mM | 0.74 mL | 3.7 mL | 7.4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
