Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Genkwanin is an antitumor constituent derived from Aquilaria sinensis leaves. |
|---|
| Catalog Num | A14787 |
|---|---|
| Formula | C16H12O5 |
| Molecular Weight | 284.26 |
| CAS Number | 437-64-9 |
| SMILES | COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=C(C=C3)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (175.89 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.18 mL | 175.9 mL | 351.79 mL |
| 0.5 mM | 7.04 mL | 35.18 mL | 70.36 mL |
| 1 mM | 3.52 mL | 17.59 mL | 35.18 mL |
| 5 mM | 0.7 mL | 3.52 mL | 7.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
