Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
WARNING: Attention California Residents: This product can expose you to chemicals including Gestodene , which is known to the State of California to cause cancer and birth defects or other reproductive harm. For more information, go to www.P65Warnings.ca.gov
| Discription | Gestodene is a progestogen hormonal contraceptive. |
|---|
| Catalog Num | A10428 |
|---|---|
| Formula | C21H26O2 |
| Molecular Weight | 310.4 |
| CAS Number | 60282-87-3 |
| SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1C=C[C@]2(C#C)O)CCC4=CC(=O)CC[C@H]34 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (186.83 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (25.77 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.22 mL | 161.08 mL | 322.16 mL |
| 0.5 mM | 6.44 mL | 32.22 mL | 64.43 mL |
| 1 mM | 3.22 mL | 16.11 mL | 32.22 mL |
| 5 mM | 0.64 mL | 3.22 mL | 6.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
