Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GI 254023X is a selective ADAM10 metalloprotease inhibitor; displays over 100-fold higher potency at ADAM10 compared to ADAM17. |
|---|
| Catalog Num | A15322 |
|---|---|
| Formula | C21H33N3O4 |
| Molecular Weight | 391.5 |
| CAS Number | 260264-93-5 |
| SMILES | CC(C(CCCC1=CC=CC=C1)C(=O)NC(C(=O)NC)C(C)(C)C)N(C=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (173.69 mM) | |
| Water | Insoluble | ||
| Ethanol | 68 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.54 mL | 127.71 mL | 255.43 mL |
| 0.5 mM | 5.11 mL | 25.54 mL | 51.09 mL |
| 1 mM | 2.55 mL | 12.77 mL | 25.54 mL |
| 5 mM | 0.51 mL | 2.55 mL | 5.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
